C24H30N2O2S2 — CID 92753047
1-[2-(1,3-dioxolan-2-yl)ethyl]-4-[(5R)-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazine (PubChem CID 92753047) has the molecular formula C24H30N2O2S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is 1-[2-(1,3-dioxolan-2-yl)ethyl]-4-[(5R)-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazine.
| Compound Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]-4-[(5R)-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazine |
|---|---|
| PubChem CID | 92753047 |
| Molecular Formula | C24H30N2O2S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]-4-[(5R)-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazine |
| SMILES | CSc1ccc2c(c1)[C@H](N1CCN(CCC3OCCO3)CC1)Cc1ccccc1S2 |
| InChI | InChI=1S/C24H30N2O2S2/c1-29-19-6-7-23-20(17-19)21(16-18-4-2-3-5-22(18)30-23)26-12-10-25(11-13-26)9-8-24-27-14-15-28-24/h2-7,17,21,24H,8-16H2,1H3/t21-/m1/s1 |
| InChIKey | BJWPYCBMSGGWGZ-OAQYLSRUSA-N |
| XLogP | 4.54 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|