C19H24N4O3S2 — CID 9275720
1-tert-butyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]thiourea (PubChem CID 9275720) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9275720 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-tert-butyl-3-[[4-[(2-methylphenyl)sulfamoyl]benzoyl]amino]thiourea |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)NNC(=S)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O3S2/c1-13-7-5-6-8-16(13)23-28(25,26)15-11-9-14(10-12-15)17(24)21-22-18(27)20-19(2,3)4/h5-12,23H,1-4H3,(H,21,24)(H2,20,22,27) |
| InChIKey | OKJRAPDXIGHNHE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|