C19H30N3O2+ — CID 9276263
(2S)-2-(4-acetylpiperazin-1-ium-1-yl)-N-[(2R)-2-phenylbutyl]propanamide (PubChem CID 9276263) has the molecular formula C19H30N3O2+ and a molecular weight of 332.47 g/mol. Its IUPAC name is (2S)-2-(4-acetylpiperazin-1-ium-1-yl)-N-[(2R)-2-phenylbutyl]propanamide.
| Compound Name | (2S)-2-(4-acetylpiperazin-1-ium-1-yl)-N-[(2R)-2-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 9276263 |
| Molecular Formula | C19H30N3O2+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (2S)-2-(4-acetylpiperazin-1-ium-1-yl)-N-[(2R)-2-phenylbutyl]propanamide |
| SMILES | CC[C@@H](CNC(=O)[C@H](C)[NH+]1CCN(C(C)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O2/c1-4-17(18-8-6-5-7-9-18)14-20-19(24)15(2)21-10-12-22(13-11-21)16(3)23/h5-9,15,17H,4,10-14H2,1-3H3,(H,20,24)/p+1/t15-,17-/m0/s1 |
| InChIKey | XNNVYPIBVUGNTB-RDJZCZTQSA-O |
| XLogP | 0.43 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |