C20H34N4O3S — CID 92764890
(2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 92764890) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 92764890 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | Cc1ccc(C)c(N([C@@H](C)C(=O)NCCCN2CCN(C)CC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H34N4O3S/c1-16-7-8-17(2)19(15-16)24(28(5,26)27)18(3)20(25)21-9-6-10-23-13-11-22(4)12-14-23/h7-8,15,18H,6,9-14H2,1-5H3,(H,21,25)/t18-/m0/s1 |
| InChIKey | JSCMKKYHDHERAJ-SFHVURJKSA-N |
| XLogP | 1.21 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|