C20H17ClN4O4S2 — CID 92765753
4-[[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 92765753) has the molecular formula C20H17ClN4O4S2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 4-[[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 92765753 |
| Molecular Formula | C20H17ClN4O4S2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 4-[[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1N1C(=O)C[C@H](Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)C1=O |
| InChI | InChI=1S/C20H17ClN4O4S2/c1-12-15(21)3-2-4-17(12)25-18(26)11-16(19(25)27)23-13-5-7-14(8-6-13)31(28,29)24-20-22-9-10-30-20/h2-10,16,23H,11H2,1H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | KNTXVQQJEJUBNH-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|