C22H24ClN3O6S — CID 41153875
(3R)-1-(3-chloro-2-methylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylanilino)pyrrolidine-2,5-dione (PubChem CID 41153875) has the molecular formula C22H24ClN3O6S and a molecular weight of 493.97 g/mol. Its IUPAC name is (3R)-1-(3-chloro-2-methylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylanilino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chloro-2-methylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41153875 |
| Molecular Formula | C22H24ClN3O6S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | (3R)-1-(3-chloro-2-methylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylanilino)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N[C@@H]2CC(=O)N(c3cccc(Cl)c3C)C2=O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H24ClN3O6S/c1-14-16(23)4-3-5-18(14)26-21(27)13-17(22(26)28)24-15-6-7-19(31-2)20(12-15)33(29,30)25-8-10-32-11-9-25/h3-7,12,17,24H,8-11,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | MEGBVTMJKDYSBJ-QGZVFWFLSA-N |
| XLogP | 2.42 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|