C20H17ClN4O4S2 — CID 42885247
4-[[1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 42885247) has the molecular formula C20H17ClN4O4S2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 4-[[1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 42885247 |
| Molecular Formula | C20H17ClN4O4S2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 4-[[1-[(4-chlorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=C1CC(Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN4O4S2/c21-14-3-1-13(2-4-14)12-25-18(26)11-17(19(25)27)23-15-5-7-16(8-6-15)31(28,29)24-20-22-9-10-30-20/h1-10,17,23H,11-12H2,(H,22,24) |
| InChIKey | QXYQUVPNYDZTJK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|