C20H20N4O5 — CID 9277211
N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 9277211) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9277211 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)Cn2c(=O)ccn(Cc3ccccc3)c2=O)c(C)o1 |
| InChI | InChI=1S/C20H20N4O5/c1-13-10-16(14(2)29-13)19(27)22-21-17(25)12-24-18(26)8-9-23(20(24)28)11-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H,21,25)(H,22,27) |
| InChIKey | OIJRXRBGANZUAE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|