C22H22N4O4 — CID 9276978
N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,4-dimethylbenzohydrazide (PubChem CID 9276978) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,4-dimethylbenzohydrazide.
| Compound Name | N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 9276978 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N'-[2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetyl]-2,4-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)Cn2c(=O)ccn(Cc3ccccc3)c2=O)c(C)c1 |
| InChI | InChI=1S/C22H22N4O4/c1-15-8-9-18(16(2)12-15)21(29)24-23-19(27)14-26-20(28)10-11-25(22(26)30)13-17-6-4-3-5-7-17/h3-12H,13-14H2,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | WYPPOOHGXFGZJK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|