C22H27N3O2 — CID 9280054
(5R)-3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9280054) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (5R)-3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9280054 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (5R)-3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CN(C)Cc2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C22H27N3O2/c1-5-22(19-9-7-6-8-10-19)20(26)25(21(27)23-22)15-24(4)14-18-12-11-16(2)13-17(18)3/h6-13H,5,14-15H2,1-4H3,(H,23,27)/t22-/m1/s1 |
| InChIKey | ZIBDFNXNGPXLRX-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|