C24H24FN3O3 — CID 92823795
(2R,4S,4aS,5S)-10-fluoro-2,4-dimethyl-1'-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 92823795) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is (2R,4S,4aS,5S)-10-fluoro-2,4-dimethyl-1'-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (2R,4S,4aS,5S)-10-fluoro-2,4-dimethyl-1'-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 92823795 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (2R,4S,4aS,5S)-10-fluoro-2,4-dimethyl-1'-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]2N(C1)c1c(F)cccc1C[C@@]21C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H24FN3O3/c1-14-11-15(2)20-24(12-16-7-6-10-18(25)19(16)27(20)13-14)21(29)26-23(31)28(22(24)30)17-8-4-3-5-9-17/h3-10,14-15,20H,11-13H2,1-2H3,(H,26,29,31)/t14-,15+,20+,24+/m1/s1 |
| InChIKey | ONVIKMVYVZZACB-DOVCQFDRSA-N |
| XLogP | 3.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|