C19H23N3O3 — CID 124528225
(2R,4S,4aS,5R)-1',2,4-trimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 124528225) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2R,4S,4aS,5R)-1',2,4-trimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (2R,4S,4aS,5R)-1',2,4-trimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 124528225 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2R,4S,4aS,5R)-1',2,4-trimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]2N(C1)c1ccccc1C[C@]21C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C19H23N3O3/c1-11-8-12(2)15-19(16(23)20-18(25)21(3)17(19)24)9-13-6-4-5-7-14(13)22(15)10-11/h4-7,11-12,15H,8-10H2,1-3H3,(H,20,23,25)/t11-,12+,15+,19-/m1/s1 |
| InChIKey | GCQXKQZJQISPAA-NCPSFGDWSA-N |
| XLogP | 1.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|