C23H23N3O3 — CID 124806445
(3S,4aS,5R)-1'-methyl-3-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 124806445) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is (3S,4aS,5R)-1'-methyl-3-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (3S,4aS,5R)-1'-methyl-3-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 124806445 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (3S,4aS,5R)-1'-methyl-3-phenylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | CN1C(=O)NC(=O)[C@]2(Cc3ccccc3N3CC[C@H](c4ccccc4)C[C@H]32)C1=O |
| InChI | InChI=1S/C23H23N3O3/c1-25-21(28)23(20(27)24-22(25)29)14-17-9-5-6-10-18(17)26-12-11-16(13-19(23)26)15-7-3-2-4-8-15/h2-10,16,19H,11-14H2,1H3,(H,24,27,29)/t16-,19-,23+/m0/s1 |
| InChIKey | APUVCZANMBRGLQ-BTCOZLQPSA-N |
| XLogP | 2.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|