C20H26N4O3 — CID 7642755
(4'aR,5S)-1-tert-butyl-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 7642755) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4'aR,5S)-1-tert-butyl-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-1-tert-butyl-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 7642755 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (4'aR,5S)-1-tert-butyl-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1CCN2c3ccccc3C[C@@]3(C(=O)NC(=O)N(C(C)(C)C)C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C20H26N4O3/c1-19(2,3)24-17(26)20(16(25)21-18(24)27)11-13-7-5-6-8-14(13)23-10-9-22(4)12-15(20)23/h5-8,15H,9-12H2,1-4H3,(H,21,25,27)/t15-,20-/m0/s1 |
| InChIKey | NSWSAHFNABCYGA-YWZLYKJASA-N |
| XLogP | 1.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|