C20H27N4O3+ — CID 11910459
(4aS,5S)-1'-tert-butyl-3-methylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 11910459) has the molecular formula C20H27N4O3+ and a molecular weight of 371.46 g/mol. Its IUPAC name is (4aS,5S)-1'-tert-butyl-3-methylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aS,5S)-1'-tert-butyl-3-methylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 11910459 |
| Molecular Formula | C20H27N4O3+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (4aS,5S)-1'-tert-butyl-3-methylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | C[NH+]1CCN2c3ccccc3C[C@@]3(C(=O)NC(=O)N(C(C)(C)C)C3=O)[C@H]2C1 |
| InChI | InChI=1S/C20H26N4O3/c1-19(2,3)24-17(26)20(16(25)21-18(24)27)11-13-7-5-6-8-14(13)23-10-9-22(4)12-15(20)23/h5-8,15H,9-12H2,1-4H3,(H,21,25,27)/p+1/t15-,20+/m1/s1 |
| InChIKey | NSWSAHFNABCYGA-QRWLVFNGSA-O |
| XLogP | -0.19 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|