C18H21N3O3S — CID 124804733
(4'aR,5R)-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 124804733) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is (4'aR,5R)-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5R)-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 124804733 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4'aR,5R)-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | CC(C)N1C(=O)NC(=O)[C@]2(Cc3ccccc3N3CCSC[C@H]32)C1=O |
| InChI | InChI=1S/C18H21N3O3S/c1-11(2)21-16(23)18(15(22)19-17(21)24)9-12-5-3-4-6-13(12)20-7-8-25-10-14(18)20/h3-6,11,14H,7-10H2,1-2H3,(H,19,22,24)/t14-,18+/m0/s1 |
| InChIKey | GIRIPXULADFCFG-KBXCAEBGSA-N |
| XLogP | 1.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|