C22H20N4O4S — CID 17037304
4-(2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-1-yl)benzamide (PubChem CID 17037304) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-(2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-1-yl)benzamide.
| Compound Name | 4-(2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-1-yl)benzamide |
|---|---|
| PubChem CID | 17037304 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-(2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]thiazino[4,3-a]quinoline]-1-yl)benzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)NC(=O)C3(Cc4ccccc4N4CCSCC43)C2=O)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c23-18(27)13-5-7-15(8-6-13)26-20(29)22(19(28)24-21(26)30)11-14-3-1-2-4-16(14)25-9-10-31-12-17(22)25/h1-8,17H,9-12H2,(H2,23,27)(H,24,28,30) |
| InChIKey | DDMCZWSOIGUACF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|