C22H28ClNO2 — CID 92525322
(2R,4R,4aS)-9-chloro-2,4,5',5'-tetramethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,2'-cyclohexane]-1',3'-dione (PubChem CID 92525322) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is (2R,4R,4aS)-9-chloro-2,4,5',5'-tetramethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,2'-cyclohexane]-1',3'-dione.
| Compound Name | (2R,4R,4aS)-9-chloro-2,4,5',5'-tetramethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,2'-cyclohexane]-1',3'-dione |
|---|---|
| PubChem CID | 92525322 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2R,4R,4aS)-9-chloro-2,4,5',5'-tetramethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,2'-cyclohexane]-1',3'-dione |
| SMILES | C[C@@H]1C[C@@H](C)[C@@H]2N(C1)c1cc(Cl)ccc1CC21C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C22H28ClNO2/c1-13-7-14(2)20-22(18(25)10-21(3,4)11-19(22)26)9-15-5-6-16(23)8-17(15)24(20)12-13/h5-6,8,13-14,20H,7,9-12H2,1-4H3/t13-,14-,20+/m1/s1 |
| InChIKey | UCSIADQIPSFJSN-JZKQVHKSSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|