C15H18F3N3O3S — CID 92823857
ethyl 2-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 92823857) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is ethyl 2-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 92823857 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | ethyl 2-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N2N=C3CCCCC[C@H]3[C@@]2(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H18F3N3O3S/c1-2-24-12(22)11-8-25-13(19-11)21-14(23,15(16,17)18)9-6-4-3-5-7-10(9)20-21/h8-9,23H,2-7H2,1H3/t9-,14-/m1/s1 |
| InChIKey | JUJKOZMSYQVHBS-YMTOWFKASA-N |
| XLogP | 3.33 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |