C24H29N3O2+2 — CID 9282681
(3aR,7aS)-2-[[4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 9282681) has the molecular formula C24H29N3O2+2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (3aR,7aS)-2-[[4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[[4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 9282681 |
| Molecular Formula | C24H29N3O2+2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | (3aR,7aS)-2-[[4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(=O)N1C[NH+]1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H27N3O2/c28-23-21-10-3-4-11-22(21)24(29)27(23)17-26-14-12-25(13-15-26)16-19-8-5-7-18-6-1-2-9-20(18)19/h1-9,21-22H,10-17H2/p+2/t21-,22+ |
| InChIKey | FYNNBNJJJSGXFF-SZPZYZBQSA-P |
| XLogP | 0.03 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|