C22H26N4O2 — CID 92849321
N-[(Z)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 92849321) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 92849321 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[(Z)-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC12CN3CCN(CC(C3)/C1=N/NC(=O)c1cc3ccccc3cc1O)C2 |
| InChI | InChI=1S/C22H26N4O2/c1-2-22-13-25-7-8-26(14-22)12-17(11-25)20(22)23-24-21(28)18-9-15-5-3-4-6-16(15)10-19(18)27/h3-6,9-10,17,27H,2,7-8,11-14H2,1H3,(H,24,28)/b23-20- |
| InChIKey | SRVVGKLJDJOPAS-ATJXCDBQSA-N |
| XLogP | 2.29 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|