C17H21N5O3 — CID 92854308
(5S,6R)-6-methyl-3-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 92854308) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (5S,6R)-6-methyl-3-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6R)-6-methyl-3-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 92854308 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (5S,6R)-6-methyl-3-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(CCn1nc3ccccn3c1=O)C2=O |
| InChI | InChI=1S/C17H21N5O3/c1-12-6-2-4-8-17(12)14(23)21(15(24)18-17)10-11-22-16(25)20-9-5-3-7-13(20)19-22/h3,5,7,9,12H,2,4,6,8,10-11H2,1H3,(H,18,24)/t12-,17+/m1/s1 |
| InChIKey | WYZASFKABZCGNI-PXAZEXFGSA-N |
| XLogP | 1.00 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|