C17H19N5O3 — CID 3000188
6-methyl-3-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 3000188) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-methyl-3-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6-methyl-3-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 3000188 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 6-methyl-3-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCCCC12NC(=O)N(Cn1nnc3ccccc3c1=O)C2=O |
| InChI | InChI=1S/C17H19N5O3/c1-11-6-4-5-9-17(11)15(24)21(16(25)18-17)10-22-14(23)12-7-2-3-8-13(12)19-20-22/h2-3,7-8,11H,4-6,9-10H2,1H3,(H,18,25) |
| InChIKey | RGBHSFBRFKIRLW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|