C12H27NO3S2 — CID 92854961
(3R)-3,7-dimethyl-1-(2-sulfosulfanylethylamino)octane (PubChem CID 92854961) has the molecular formula C12H27NO3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is (3R)-3,7-dimethyl-1-(2-sulfosulfanylethylamino)octane.
| Compound Name | (3R)-3,7-dimethyl-1-(2-sulfosulfanylethylamino)octane |
|---|---|
| PubChem CID | 92854961 |
| Molecular Formula | C12H27NO3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3R)-3,7-dimethyl-1-(2-sulfosulfanylethylamino)octane |
| SMILES | CC(C)CCC[C@@H](C)CCNCCSS(=O)(=O)O |
| InChI | InChI=1S/C12H27NO3S2/c1-11(2)5-4-6-12(3)7-8-13-9-10-17-18(14,15)16/h11-13H,4-10H2,1-3H3,(H,14,15,16)/t12-/m1/s1 |
| InChIKey | JCONBDKVSVCZHB-GFCCVEGCSA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|