C25H22Cl2N2O — CID 92856051
(1S)-2-(benzylamino)-1-[7-chloro-2-(4-chlorophenyl)-8-methylquinolin-4-yl]ethanol (PubChem CID 92856051) has the molecular formula C25H22Cl2N2O and a molecular weight of 437.37 g/mol. Its IUPAC name is (1S)-2-(benzylamino)-1-[7-chloro-2-(4-chlorophenyl)-8-methylquinolin-4-yl]ethanol.
| Compound Name | (1S)-2-(benzylamino)-1-[7-chloro-2-(4-chlorophenyl)-8-methylquinolin-4-yl]ethanol |
|---|---|
| PubChem CID | 92856051 |
| Molecular Formula | C25H22Cl2N2O |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (1S)-2-(benzylamino)-1-[7-chloro-2-(4-chlorophenyl)-8-methylquinolin-4-yl]ethanol |
| SMILES | Cc1c(Cl)ccc2c([C@H](O)CNCc3ccccc3)cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C25H22Cl2N2O/c1-16-22(27)12-11-20-21(24(30)15-28-14-17-5-3-2-4-6-17)13-23(29-25(16)20)18-7-9-19(26)10-8-18/h2-13,24,28,30H,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | QGSBHKGMFVUSRO-XMMPIXPASA-N |
| XLogP | 6.34 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |