C10H15NO3 — CID 92857441
1-[(1S,2R)-2-[(Z)-2-nitroethenyl]cyclohexyl]ethanone (PubChem CID 92857441) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-[(1S,2R)-2-[(Z)-2-nitroethenyl]cyclohexyl]ethanone.
| Compound Name | 1-[(1S,2R)-2-[(Z)-2-nitroethenyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 92857441 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-[(1S,2R)-2-[(Z)-2-nitroethenyl]cyclohexyl]ethanone |
| SMILES | CC(=O)[C@H]1CCCC[C@@H]1/C=C\[N+](=O)[O-] |
| InChI | InChI=1S/C10H15NO3/c1-8(12)10-5-3-2-4-9(10)6-7-11(13)14/h6-7,9-10H,2-5H2,1H3/b7-6-/t9-,10-/m1/s1 |
| InChIKey | XTHPQJZNZALQTH-ITMFEAPISA-N |
| XLogP | 2.17 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|