C20H22FN3O3S — CID 92857496
2-[4-[(5S)-9-fluoro-3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]ethanol (PubChem CID 92857496) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[4-[(5S)-9-fluoro-3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(5S)-9-fluoro-3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 92857496 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[4-[(5S)-9-fluoro-3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H](N1CCN(CCO)CC1)Cc1ccc(F)cc1S2 |
| InChI | InChI=1S/C20H22FN3O3S/c21-15-2-1-14-11-18(23-7-5-22(6-8-23)9-10-25)17-13-16(24(26)27)3-4-19(17)28-20(14)12-15/h1-4,12-13,18,25H,5-11H2/t18-/m0/s1 |
| InChIKey | SYZQQZSBHCAWAX-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|