C21H29N3O8S3 — CID 3049434
methanesulfonic acid;1-methyl-4-(3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine (PubChem CID 3049434) has the molecular formula C21H29N3O8S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is methanesulfonic acid;1-methyl-4-(3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine.
| Compound Name | methanesulfonic acid;1-methyl-4-(3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine |
|---|---|
| PubChem CID | 3049434 |
| Molecular Formula | C21H29N3O8S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | methanesulfonic acid;1-methyl-4-(3-nitro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine |
| SMILES | CN1CCN(C2Cc3cc([N+](=O)[O-])ccc3Sc3ccccc32)CC1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C19H21N3O2S.2CH4O3S/c1-20-8-10-21(11-9-20)17-13-14-12-15(22(23)24)6-7-18(14)25-19-5-3-2-4-16(17)19;2*1-5(2,3)4/h2-7,12,17H,8-11,13H2,1H3;2*1H3,(H,2,3,4) |
| InChIKey | KIYMEQDYNWFDLS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|