C14H19F2N3O2S — CID 159039089
1-[(1S)-3,3-difluoro-5-nitro-1,2-dihydroinden-1-yl]-4-methylpiperazine;sulfane (PubChem CID 159039089) has the molecular formula C14H19F2N3O2S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[(1S)-3,3-difluoro-5-nitro-1,2-dihydroinden-1-yl]-4-methylpiperazine;sulfane.
| Compound Name | 1-[(1S)-3,3-difluoro-5-nitro-1,2-dihydroinden-1-yl]-4-methylpiperazine;sulfane |
|---|---|
| PubChem CID | 159039089 |
| Molecular Formula | C14H19F2N3O2S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[(1S)-3,3-difluoro-5-nitro-1,2-dihydroinden-1-yl]-4-methylpiperazine;sulfane |
| SMILES | CN1CCN([C@H]2CC(F)(F)c3cc([N+](=O)[O-])ccc32)CC1.S |
| InChI | InChI=1S/C14H17F2N3O2.H2S/c1-17-4-6-18(7-5-17)13-9-14(15,16)12-8-10(19(20)21)2-3-11(12)13;/h2-3,8,13H,4-7,9H2,1H3;1H2/t13-;/m0./s1 |
| InChIKey | JVVDNPDXZBLYAJ-ZOWNYOTGSA-N |
| XLogP | 2.49 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|