C12H14F2N2O2 — CID 102366377
3,3-difluoro-5-nitro-N-propan-2-yl-1,2-dihydroinden-2-amine (PubChem CID 102366377) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 3,3-difluoro-5-nitro-N-propan-2-yl-1,2-dihydroinden-2-amine.
| Compound Name | 3,3-difluoro-5-nitro-N-propan-2-yl-1,2-dihydroinden-2-amine |
|---|---|
| PubChem CID | 102366377 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3,3-difluoro-5-nitro-N-propan-2-yl-1,2-dihydroinden-2-amine |
| SMILES | CC(C)NC1Cc2ccc([N+](=O)[O-])cc2C1(F)F |
| InChI | InChI=1S/C12H14F2N2O2/c1-7(2)15-11-5-8-3-4-9(16(17)18)6-10(8)12(11,13)14/h3-4,6-7,11,15H,5H2,1-2H3 |
| InChIKey | BSAXLAWSWGATHW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|