C12H12F2N2O3 — CID 102432657
4,4-difluoro-2,2-dimethyl-6-nitro-1,3a-dihydro-[1,3]oxazolo[3,2-a]indole (PubChem CID 102432657) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4,4-difluoro-2,2-dimethyl-6-nitro-1,3a-dihydro-[1,3]oxazolo[3,2-a]indole.
| Compound Name | 4,4-difluoro-2,2-dimethyl-6-nitro-1,3a-dihydro-[1,3]oxazolo[3,2-a]indole |
|---|---|
| PubChem CID | 102432657 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4,4-difluoro-2,2-dimethyl-6-nitro-1,3a-dihydro-[1,3]oxazolo[3,2-a]indole |
| SMILES | CC1(C)CN2c3ccc([N+](=O)[O-])cc3C(F)(F)C2O1 |
| InChI | InChI=1S/C12H12F2N2O3/c1-11(2)6-15-9-4-3-7(16(17)18)5-8(9)12(13,14)10(15)19-11/h3-5,10H,6H2,1-2H3 |
| InChIKey | KSLSQXMMTWMQBY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|