C22H27ClN2O3S2 — CID 3070446
2-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;methanesulfonic acid (PubChem CID 3070446) has the molecular formula C22H27ClN2O3S2 and a molecular weight of 467.06 g/mol. Its IUPAC name is 2-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;methanesulfonic acid.
| Compound Name | 2-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;methanesulfonic acid |
|---|---|
| PubChem CID | 3070446 |
| Molecular Formula | C22H27ClN2O3S2 |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Clc1ccc2c(c1)C(N1CCN3CCCC3C1)Cc1ccccc1S2 |
| InChI | InChI=1S/C21H23ClN2S.CH4O3S/c22-16-7-8-21-18(13-16)19(12-15-4-1-2-6-20(15)25-21)24-11-10-23-9-3-5-17(23)14-24;1-5(2,3)4/h1-2,4,6-8,13,17,19H,3,5,9-12,14H2;1H3,(H,2,3,4) |
| InChIKey | DOXNFWYWHGDYCV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|