C16H23N3O — CID 92863343
(1S)-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 92863343) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (1S)-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 92863343 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (1S)-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCc1cn2c(n1)CCCC2)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C16H23N3O/c20-16(13-6-2-1-3-7-13)17-10-9-14-12-19-11-5-4-8-15(19)18-14/h1-2,12-13H,3-11H2,(H,17,20)/t13-/m1/s1 |
| InChIKey | PZYJKORQIGTFBH-CYBMUJFWSA-N |
| XLogP | 2.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|