C23H33N5O — CID 97339514
(7R)-3-cyclohexyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 97339514) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is (7R)-3-cyclohexyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | (7R)-3-cyclohexyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 97339514 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (7R)-3-cyclohexyl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | O=C(NCCc1cn2c(n1)CCCC2)[C@@H]1CCn2c(cnc2C2CCCCC2)C1 |
| InChI | InChI=1S/C23H33N5O/c29-23(24-11-9-19-16-27-12-5-4-8-21(27)26-19)18-10-13-28-20(14-18)15-25-22(28)17-6-2-1-3-7-17/h15-18H,1-14H2,(H,24,29)/t18-/m1/s1 |
| InChIKey | DNBZZWYYYILACO-GOSISDBHSA-N |
| XLogP | 3.38 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |