C23H24ClN3O3 — CID 92867317
1-[(4-chlorophenyl)methyl]-4-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione (PubChem CID 92867317) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 92867317 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione |
| SMILES | C[C@H]1CCCN(C(=O)Cn2c(=O)c(=O)n(Cc3ccc(Cl)cc3)c3ccccc32)C1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-16-5-4-12-25(13-16)21(28)15-27-20-7-3-2-6-19(20)26(22(29)23(27)30)14-17-8-10-18(24)11-9-17/h2-3,6-11,16H,4-5,12-15H2,1H3/t16-/m0/s1 |
| InChIKey | JWXCBFDPPNDSAD-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|