C27H27ClN2O3 — CID 92872314
N-[(3-chlorophenyl)methyl]-3-[(3R)-1-(4-methoxybenzoyl)piperidin-3-yl]benzamide (PubChem CID 92872314) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-[(3R)-1-(4-methoxybenzoyl)piperidin-3-yl]benzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-[(3R)-1-(4-methoxybenzoyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 92872314 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-[(3R)-1-(4-methoxybenzoyl)piperidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N2CCC[C@H](c3cccc(C(=O)NCc4cccc(Cl)c4)c3)C2)cc1 |
| InChI | InChI=1S/C27H27ClN2O3/c1-33-25-12-10-20(11-13-25)27(32)30-14-4-8-23(18-30)21-6-3-7-22(16-21)26(31)29-17-19-5-2-9-24(28)15-19/h2-3,5-7,9-13,15-16,23H,4,8,14,17-18H2,1H3,(H,29,31)/t23-/m0/s1 |
| InChIKey | GVNIKLAKGWFNJR-QHCPKHFHSA-N |
| XLogP | 5.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |