C14H20N2O — CID 928825
(1R,4aR,9aS)-7-methoxy-1,9-dimethyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indole (PubChem CID 928825) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (1R,4aR,9aS)-7-methoxy-1,9-dimethyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indole.
| Compound Name | (1R,4aR,9aS)-7-methoxy-1,9-dimethyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 928825 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1R,4aR,9aS)-7-methoxy-1,9-dimethyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indole |
| SMILES | COc1ccc2c(c1)N(C)[C@H]1[C@@H]2CCN[C@@H]1C |
| InChI | InChI=1S/C14H20N2O/c1-9-14-12(6-7-15-9)11-5-4-10(17-3)8-13(11)16(14)2/h4-5,8-9,12,14-15H,6-7H2,1-3H3/t9-,12-,14-/m1/s1 |
| InChIKey | AJIJUGAQRBRAJB-GAJTVXKRSA-N |
| XLogP | 1.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |