C15H19N3O3 — CID 73259610
5-(3-methoxyphenyl)-1-methyl-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 73259610) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1-methyl-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(3-methoxyphenyl)-1-methyl-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73259610 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-(3-methoxyphenyl)-1-methyl-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1cccc(C2CCNC3C2C(=O)NC(=O)N3C)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-18-13-12(14(19)17-15(18)20)11(6-7-16-13)9-4-3-5-10(8-9)21-2/h3-5,8,11-13,16H,6-7H2,1-2H3,(H,17,19,20) |
| InChIKey | VELUIYAPEXTOCH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |