C23H23N3O3S — CID 92882611
(2S)-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-3-one (PubChem CID 92882611) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is (2S)-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-3-one.
| Compound Name | (2S)-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 92882611 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (2S)-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-3-one |
| SMILES | O=C([C@@H]1Sc2ccccc2N(CC(=O)N2CCc3ccccc32)C1=O)N1CCCC1 |
| InChI | InChI=1S/C23H23N3O3S/c27-20(25-14-11-16-7-1-2-8-17(16)25)15-26-18-9-3-4-10-19(18)30-21(23(26)29)22(28)24-12-5-6-13-24/h1-4,7-10,21H,5-6,11-15H2/t21-/m0/s1 |
| InChIKey | PTYPCYPOZCDXGG-NRFANRHFSA-N |
| XLogP | 2.71 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|