C26H29ClN4O2S — CID 92883206
4-[3-(4-chlorophenyl)sulfanylpyrazin-2-yl]oxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 92883206) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)sulfanylpyrazin-2-yl]oxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-[3-(4-chlorophenyl)sulfanylpyrazin-2-yl]oxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 92883206 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[3-(4-chlorophenyl)sulfanylpyrazin-2-yl]oxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)c2ccc(Oc3nccnc3Sc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C26H29ClN4O2S/c1-19-4-2-16-31(18-19)17-3-13-28-24(32)20-5-9-22(10-6-20)33-25-26(30-15-14-29-25)34-23-11-7-21(27)8-12-23/h5-12,14-15,19H,2-4,13,16-18H2,1H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | IJWOZCITLCGLCP-IBGZPJMESA-N |
| XLogP | 5.93 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|