C23H31N3O4S — CID 92886996
ethyl (3S)-1-[6-(4-methylpiperidin-1-yl)sulfonylquinolin-2-yl]piperidine-3-carboxylate (PubChem CID 92886996) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is ethyl (3S)-1-[6-(4-methylpiperidin-1-yl)sulfonylquinolin-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[6-(4-methylpiperidin-1-yl)sulfonylquinolin-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92886996 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl (3S)-1-[6-(4-methylpiperidin-1-yl)sulfonylquinolin-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc3cc(S(=O)(=O)N4CCC(C)CC4)ccc3n2)C1 |
| InChI | InChI=1S/C23H31N3O4S/c1-3-30-23(27)19-5-4-12-25(16-19)22-9-6-18-15-20(7-8-21(18)24-22)31(28,29)26-13-10-17(2)11-14-26/h6-9,15,17,19H,3-5,10-14,16H2,1-2H3/t19-/m0/s1 |
| InChIKey | SFHHKICUSXCNPI-IBGZPJMESA-N |
| XLogP | 3.43 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |