C16H21N3O4S — CID 92888514
methyl 5-ethyl-3-[[(2S)-2-phenylpropyl]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 92888514) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is methyl 5-ethyl-3-[[(2S)-2-phenylpropyl]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 5-ethyl-3-[[(2S)-2-phenylpropyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 92888514 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 5-ethyl-3-[[(2S)-2-phenylpropyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCc1[nH]nc(S(=O)(=O)NC[C@@H](C)c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C16H21N3O4S/c1-4-13-14(16(20)23-3)15(19-18-13)24(21,22)17-10-11(2)12-8-6-5-7-9-12/h5-9,11,17H,4,10H2,1-3H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | CLRKZAPLGGYHBF-LLVKDONJSA-N |
| XLogP | 1.84 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |