C17H24N4O4S — CID 92889833
N-[(2R)-butan-2-yl]-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 92889833) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 92889833 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)C1CCN(S(=O)(=O)c2ccc(-c3ccn[nH]3)o2)CC1 |
| InChI | InChI=1S/C17H24N4O4S/c1-3-12(2)19-17(22)13-7-10-21(11-8-13)26(23,24)16-5-4-15(25-16)14-6-9-18-20-14/h4-6,9,12-13H,3,7-8,10-11H2,1-2H3,(H,18,20)(H,19,22)/t12-/m1/s1 |
| InChIKey | CGYHJIPMGIKODB-GFCCVEGCSA-N |
| XLogP | 1.99 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |