C25H31N5O3 — CID 92900276
(3R)-1-N-[4-[(2,4-dimethylphenyl)carbamoylamino]phenyl]-3-N-prop-2-enylpiperidine-1,3-dicarboxamide (PubChem CID 92900276) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (3R)-1-N-[4-[(2,4-dimethylphenyl)carbamoylamino]phenyl]-3-N-prop-2-enylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[4-[(2,4-dimethylphenyl)carbamoylamino]phenyl]-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 92900276 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3R)-1-N-[4-[(2,4-dimethylphenyl)carbamoylamino]phenyl]-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(NC(=O)Nc3ccc(C)cc3C)cc2)C1 |
| InChI | InChI=1S/C25H31N5O3/c1-4-13-26-23(31)19-6-5-14-30(16-19)25(33)28-21-10-8-20(9-11-21)27-24(32)29-22-12-7-17(2)15-18(22)3/h4,7-12,15,19H,1,5-6,13-14,16H2,2-3H3,(H,26,31)(H,28,33)(H2,27,29,32)/t19-/m1/s1 |
| InChIKey | SBMWTYJMKDULGG-LJQANCHMSA-N |
| XLogP | 4.49 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|