C25H28N4O2 — CID 92901391
N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(3-morpholin-4-ylpyrazin-2-yl)benzamide (PubChem CID 92901391) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(3-morpholin-4-ylpyrazin-2-yl)benzamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(3-morpholin-4-ylpyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 92901391 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(3-morpholin-4-ylpyrazin-2-yl)benzamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2cccc(-c3nccnc3N3CCOCC3)c2)c(C)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-17-7-8-22(18(2)15-17)19(3)28-25(30)21-6-4-5-20(16-21)23-24(27-10-9-26-23)29-11-13-31-14-12-29/h4-10,15-16,19H,11-14H2,1-3H3,(H,28,30)/t19-/m1/s1 |
| InChIKey | YFUCGSZFLNFULI-LJQANCHMSA-N |
| XLogP | 4.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |