C25H32N4O7S2 — CID 92905061
N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-4-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 92905061) has the molecular formula C25H32N4O7S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-4-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-4-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 92905061 |
| Molecular Formula | C25H32N4O7S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-4-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)NNC(=O)c3ccc(S(=O)(=O)N4CCCCC4)cc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H32N4O7S2/c1-18-16-29(17-19(2)36-18)38(34,35)23-12-8-21(9-13-23)25(31)27-26-24(30)20-6-10-22(11-7-20)37(32,33)28-14-4-3-5-15-28/h6-13,18-19H,3-5,14-17H2,1-2H3,(H,26,30)(H,27,31)/t18-,19+ |
| InChIKey | JEIDGTUUMDAEHN-KDURUIRLSA-N |
| XLogP | 1.73 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|