C32H27FN4O4S2 — CID 92905545
(3R,10bR)-2-(benzenesulfonyl)-3-[1-(benzenesulfonyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3,5,6,10b-tetrahydro-1H-imidazo[5,1-a]isoquinoline (PubChem CID 92905545) has the molecular formula C32H27FN4O4S2 and a molecular weight of 614.72 g/mol. Its IUPAC name is (3R,10bR)-2-(benzenesulfonyl)-3-[1-(benzenesulfonyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3,5,6,10b-tetrahydro-1H-imidazo[5,1-a]isoquinoline.
| Compound Name | (3R,10bR)-2-(benzenesulfonyl)-3-[1-(benzenesulfonyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3,5,6,10b-tetrahydro-1H-imidazo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 92905545 |
| Molecular Formula | C32H27FN4O4S2 |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | (3R,10bR)-2-(benzenesulfonyl)-3-[1-(benzenesulfonyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3,5,6,10b-tetrahydro-1H-imidazo[5,1-a]isoquinoline |
| SMILES | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CCN2[C@H]1c1cn(S(=O)(=O)c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H27FN4O4S2/c33-25-17-15-24(16-18-25)31-29(21-37(34-31)43(40,41)27-12-5-2-6-13-27)32-35-20-19-23-9-7-8-14-28(23)30(35)22-36(32)42(38,39)26-10-3-1-4-11-26/h1-18,21,30,32H,19-20,22H2/t30-,32+/m0/s1 |
| InChIKey | SZFBKVLEPNTRNK-XDFJSJKPSA-N |
| XLogP | 5.23 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |