C16H12F12N2O2 — CID 92905725
(2S)-2,3,3,3-tetrafluoro-1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-one (PubChem CID 92905725) has the molecular formula C16H12F12N2O2 and a molecular weight of 492.26 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-one.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 92905725 |
| Molecular Formula | C16H12F12N2O2 |
| Molecular Weight | 492.26 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-one |
| SMILES | O=C(N1CCN(c2ccc(F)cc2)CC1)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H12F12N2O2/c17-9-1-3-10(4-2-9)29-5-7-30(8-6-29)11(31)12(18,14(21,22)23)32-16(27,28)13(19,20)15(24,25)26/h1-4H,5-8H2/t12-/m1/s1 |
| InChIKey | ZCFZMWAVLUHMPN-GFCCVEGCSA-N |
| XLogP | 4.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|