C19H23NO3 — CID 929135
(3aS,4R,7S,7aR)-2-(furan-2-ylmethyl)-4,5-dimethyl-7-(2-methylprop-1-enyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 929135) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-(furan-2-ylmethyl)-4,5-dimethyl-7-(2-methylprop-1-enyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-(furan-2-ylmethyl)-4,5-dimethyl-7-(2-methylprop-1-enyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 929135 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-(furan-2-ylmethyl)-4,5-dimethyl-7-(2-methylprop-1-enyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)=C[C@H]1C=C(C)[C@H](C)[C@@H]2C(=O)N(Cc3ccco3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H23NO3/c1-11(2)8-14-9-12(3)13(4)16-17(14)19(22)20(18(16)21)10-15-6-5-7-23-15/h5-9,13-14,16-17H,10H2,1-4H3/t13-,14-,16-,17+/m0/s1 |
| InChIKey | KIACIYWUDNJWJO-NXNVCVFFSA-N |
| XLogP | 3.56 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|