C19H16ClN5O — CID 92919190
(9aS)-1-(4-chlorophenyl)-4-oxo-8-phenyl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-3-carbonitrile (PubChem CID 92919190) has the molecular formula C19H16ClN5O and a molecular weight of 365.82 g/mol. Its IUPAC name is (9aS)-1-(4-chlorophenyl)-4-oxo-8-phenyl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-3-carbonitrile.
| Compound Name | (9aS)-1-(4-chlorophenyl)-4-oxo-8-phenyl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-3-carbonitrile |
|---|---|
| PubChem CID | 92919190 |
| Molecular Formula | C19H16ClN5O |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (9aS)-1-(4-chlorophenyl)-4-oxo-8-phenyl-6,7,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-3-carbonitrile |
| SMILES | N#CC1=NN(c2ccc(Cl)cc2)[C@H]2CN(c3ccccc3)CCN2C1=O |
| InChI | InChI=1S/C19H16ClN5O/c20-14-6-8-16(9-7-14)25-18-13-23(15-4-2-1-3-5-15)10-11-24(18)19(26)17(12-21)22-25/h1-9,18H,10-11,13H2/t18-/m0/s1 |
| InChIKey | GBNDJDCQDBPGGP-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 62.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |